Guacetisal: Difference between revisions
Appearance
Content deleted Content added
m added FDA UNII to drug box |
Remove malformatted |molecular_weight= when infobox can autocalculate it, per Wikipedia talk:WikiProject Pharmacology#Molecular weights in drugboxes (via WP:JWB) |
||
Line 42: | Line 42: | ||
<!-- Chemical data --> |
<!-- Chemical data --> |
||
| C=16 | H=14 | O=5 |
| C=16 | H=14 | O=5 |
||
| molecular_weight = 286.279 g/mol |
|||
| smiles = O=C(Oc1ccccc1C(=O)Oc2ccccc2OC)C |
| smiles = O=C(Oc1ccccc1C(=O)Oc2ccccc2OC)C |
||
| StdInChI = 1S/C16H14O5/c1-11(17)20-13-8-4-3-7-12(13)16(18)21-15-10-6-5-9-14(15)19-2/h3-10H,1-2H3 |
| StdInChI = 1S/C16H14O5/c1-11(17)20-13-8-4-3-7-12(13)16(18)21-15-10-6-5-9-14(15)19-2/h3-10H,1-2H3 |
Revision as of 04:21, 22 June 2020
Clinical data | |
---|---|
Trade names | Broncaspin; Balsacetil; Guaiaspir; Prontomucil |
Other names | Aspirin guaiacol ester; O-Methoxyphenyl salicylate acetate |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.054.221 |
Chemical and physical data | |
Formula | C16H14O5 |
Molar mass | 286.283 g·mol−1 |
3D model (JSmol) | |
Melting point | 72 to 74.5 °C (161.6 to 166.1 °F) |
| |
|
Guacetisal is a drug that has been used to treat inflammatory respiratory diseases.[1] Chemically, it is an ester resulting from the combination of aspirin and guaiacol.