Deksibuprofen – razlika između verzija
m . |
m + |
||
| Red 2: | Red 2: | ||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = 443586803 |
| verifiedrevid = 443586803 |
||
| IUPAC_name = (2-{''S'' |
| IUPAC_name = (2-{''S'')-2-[4-(2-metilpropil)fenil]propanska kiselina |
||
| image = Dexibuprofen Structural Formulae V.1.svg |
| image = Dexibuprofen Structural Formulae V.1.svg |
||
| width = |
| width = |
||
| Red 51: | Red 51: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=13 | H=18 | O=2 |
| C=13 | H=18 | O=2 |
||
| molecular_weight = 206.28082 -{g/mol |
| molecular_weight = 206.28082 -{g/mol |
||
| smiles = C[C@@H](c1ccc(cc1)CC(C)C)C(=O)O |
| smiles = C[C@@H](c1ccc(cc1)CC(C)C)C(=O)O |
||
| InChI = 1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| InChI = 1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
||
Verzija od 7. aprila 2014. u 03:17
{{Drugbox-lat | Watchedfields = changed | verifiedrevid = 443586803 | IUPAC_name = (2-{S)-2-[4-(2-metilpropil)fenil]propanska kiselina | image = Dexibuprofen Structural Formulae V.1.svg | width = | image2 = (S)-ibuprofen-3D-balls.png | width2 =
| tradename = | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oralno
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CASNo_Ref = 
| CAS_number_Ref =
| CAS_number = 51146-56-6
| ATC_prefix = M01
| ATC_suffix = AE14
| PubChem = 39912
| IUPHAR_ligand =
| DrugBank_Ref = Šablon:Drugbankcite
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 36498
| UNII_Ref =
| UNII = 671DKG7P5S
| KEGG_Ref =
| KEGG = D03715
| ChEBI_Ref =
| ChEBI = 43415
| ChEMBL_Ref =
| ChEMBL = 175
| C=13 | H=18 | O=2
| molecular_weight = 206.28082 -{g/mol
| smiles = C[C@@H](c1ccc(cc1)CC(C)C)C(=O)O
| InChI = 1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1
| InChIKey = HEFNNWSXXWATRW-JTQLQIEIBT
| StdInChI_Ref =
| StdInChI = 1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = HEFNNWSXXWATRW-JTQLQIEISA-N
}}
Dexibuprofen je nesteroidni antiinflamatorni lek. On je aktivni dekstrorotatorni enantiomer ibuprofena. Većina ibuprofenskih formulacija sadrži racemsku smešu deksibuprofen (+)-iboprofena i (−)-ibuprofena.[1]
Reference
- ↑ Hardman JG, Limbird LE, Gilman AG. (2001). Goodman & Gilman's The Pharmacological Basis of Therapeutics (10 izd.). New York: McGraw-Hill. DOI:10.1036/0071422803. ISBN 0-07-135469-7.
