Delapril: Difference between revisions

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444593478

| IUPAC_name = 2-[2,3-dihydro-1''H''-inden-2-yl-[(2''S'')-2-<nowiki>[[</nowiki>(2''S'')-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]amino]acetic acid

| image = Delapril.svg

| width = 222

<!--Clinical data-->

| tradename =

| Drugs.com = {{drugs.com|international|delapril}}

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category =

| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->

| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

| routes_of_administration =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 83435-66-9

| ATC_prefix = C09

| ATC_suffix = AA12

| ATC_supplemental =

| PubChem = 5362116

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2106126

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4514931

| SMILES = O=C(OCC)[C@@H](N[C@H](C(=O)N(CC(=O)O)C2Cc1ccccc1C2)C)CCc3ccccc3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H32N2O5/c1-3-33-26(32)23(14-13-19-9-5-4-6-10-19)27-18(2)25(31)28(17-24(29)30)22-15-20-11-7-8-12-21(20)16-22/h4-12,18,22-23,27H,3,13-17H2,1-2H3,(H,29,30)/t18-,23-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = WOUOLAUOZXOLJQ-MBSDFSHPSA-N

<!--Chemical data-->

| C=26 | H=32 | N=2 | O=5

'''Delapril''' ([[International Nonproprietary Name|INN]], also known as '''alindapril''') is an [[ACE inhibitor]] used as an [[antihypertensive]] drug<ref>{{cite journal | vauthors = Otero ML | title = Manidipine-delapril combination in the management of hypertension | journal = Vascular Health and Risk Management | volume = 3 | issue = 3 | pages = 255–63 | year = 2007 | pmid = 17703633 | pmc = 2293964 }}</ref> in some European and Asian countries but not in America.<ref>{{cite web | work = Drugs.com | url = https://www.drugs.com/international/delapril.html | title = Delapril }}</ref> It is taken orally, available in 15&nbsp;mg and 30&nbsp;mg tablets.<ref>{{cite web | url = http://cursoenarm.net/UPTODATE/contents/mobipreview.htm?16/0/16396?source=HISTORY |title= Delapril |website=cursoenarm.net |access-date=2016-08-28 }}</ref>

== Mechanism ==

Delapril is a prodrug; it is converted into two active metabolites, 5-hydroxy delapril diacid and delapril diacid. These metabolites bind completely to and inhibit [[angiotensin-converting enzyme]] (ACE), hence blocking angiotensin I to angiotensin II conversion. The resulting vasodilation prevents the vasoconstrictive effects of angiotensin II. Angiotensin II-induced aldosterone secretion by the adrenal cortex is also decreased by Delapril, leading to increases in excretion of sodium and therefore increases water outflow.<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/delapril#section=Pharmacology-and-Biochemistry |title= Delapril | work = Pubchem | publisher = U.S. National Library of Medicine |access-date=2016-08-28}}</ref>

== References ==

{{reflist}}

{{Angiotensin receptor modulators}}

[[Category:2-Aminoindanes]]

[[Category:Enantiopure drugs]]

[[Category:Propionamides]]

[[Category:Drugs developed by Takeda Pharmaceutical Company]]